CAS 1353972-53-8

1,2-Cyclohexanediamine, N1-[(3-chlorophenyl)methyl]-, hydrochloride (1:1)

Description:

1,2-Cyclohexanediamine, N1-[(3-chlorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its cyclic structure and the presence of two amine groups. The compound features a cyclohexane ring with two amine substituents at the 1 and 2 positions, which contributes to its potential as a bidentate ligand in coordination chemistry. The addition of a 3-chlorobenzyl group enhances its lipophilicity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceuticals. The presence of the chloride ion can also affect the compound's stability and reactivity. This compound may exhibit properties such as basicity due to the amine groups and can participate in hydrogen bonding, making it relevant in medicinal chemistry and material science. Its specific applications and biological activities would depend on further studies and evaluations.

Formula: C₁₃H₁₉ClN₂·ClH

InChI: InChI=1S/C13H19ClN2.ClH/c14-11-5-3-4-10(8-11)9-16-13-7-2-1-6-12(13)15;/h3-5,8,12-13,16H,1-2,6-7,9,15H2;1H

InChI key: InChIKey=MWQFKQKOGQNTLI-UHFFFAOYSA-N

SMILES: N(CC1=CC(Cl)=CC=C1)C2C(N)CCCC2.Cl

Synonyms:

• 1,2-Cyclohexanediamine, N1-[(3-chlorophenyl)methyl]-, hydrochloride (1:1)

N1-(3-Chlorobenzyl)cyclohexane-1,2-diamine hydrochloride

CAS: 1353972-53-8

Formula: C₁₃H₂₀Cl₂N₂

Molecular weight: 275.2173

Ref: IN-DA00HU3A