CAS 1353972-66-3
:1-Piperidineacetic acid, 4-[[cyclopropyl[(1,1-dimethylethoxy)carbonyl]amino]methyl]-
Description:
1-Piperidineacetic acid, 4-[[cyclopropyl[(1,1-dimethylethoxy)carbonyl]amino]methyl]- is a chemical compound characterized by its complex structure, which includes a piperidine ring and an acetic acid moiety. The presence of a cyclopropyl group and a dimethylethoxycarbonyl substituent contributes to its unique properties. This compound is likely to exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid functional group, while the hydrophobic cyclopropyl and dimethylethoxy groups may influence its overall lipophilicity. The piperidine ring can participate in various chemical reactions, making it a versatile building block in organic synthesis. Additionally, the compound may exhibit biological activity, potentially serving as a lead compound in pharmaceutical research. Its specific interactions and reactivity would depend on the functional groups present and their spatial arrangement, which could affect its pharmacokinetic and pharmacodynamic properties. As with many such compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C16H28N2O4
InChI:InChI=1S/C16H28N2O4/c1-16(2,3)22-15(21)18(13-4-5-13)10-12-6-8-17(9-7-12)11-14(19)20/h12-13H,4-11H2,1-3H3,(H,19,20)
InChI key:InChIKey=KITZVGBQSHKBEF-UHFFFAOYSA-N
SMILES:N(CC1CCN(CC(O)=O)CC1)(C(OC(C)(C)C)=O)C2CC2
Synonyms:- 2-[4-[[Cyclopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]piperidin-1-yl]acetic acid
- {4-[(tert-Butoxycarbonyl-cyclopropyl-amino)-methyl]-piperidin-1-yl}-acetic acid
- 1-Piperidineacetic acid, 4-[[cyclopropyl[(1,1-dimethylethoxy)carbonyl]amino]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.