CAS 1353973-08-6

Phenylmethyl N-[2-[(2-aminoethyl)cyclopropylamino]cyclohexyl]carbamate

Description:

Phenylmethyl N-[2-[(2-aminoethyl)cyclopropylamino]cyclohexyl]carbamate, identified by its CAS number 1353973-08-6, is a chemical compound that belongs to the class of carbamates. This substance features a complex molecular structure characterized by the presence of a phenylmethyl group, a cyclohexyl moiety, and a cyclopropylamine derivative, which contribute to its unique properties. The compound is likely to exhibit moderate to high lipophilicity due to the aromatic and aliphatic components, influencing its solubility in organic solvents. Its potential biological activity may stem from the presence of amino groups, which can participate in hydrogen bonding and receptor interactions. As a carbamate, it may also exhibit characteristics typical of this class, such as susceptibility to hydrolysis and potential neurotoxic effects, depending on its specific interactions within biological systems. Overall, the compound's intricate structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways.

Formula: C₁₉H₂₉N₃O₂

InChI: InChI=1S/C19H29N3O2/c20-12-13-22(16-10-11-16)18-9-5-4-8-17(18)21-19(23)24-14-15-6-2-1-3-7-15/h1-3,6-7,16-18H,4-5,8-14,20H2,(H,21,23)

InChI key: InChIKey=ASJWIBRFFMOXHH-UHFFFAOYSA-N

SMILES: N(CCN)(C1C(NC(OCC2=CC=CC=C2)=O)CCCC1)C3CC3

Synonyms:

• Carbamic acid, N-[2-[(2-aminoethyl)cyclopropylamino]cyclohexyl]-, phenylmethyl ester
• {2-[(2-Amino-ethyl)-cyclopropyl-amino]-cyclohexyl}-carbamic acid benzyl ester
• Phenylmethyl N-[2-[(2-aminoethyl)cyclopropylamino]cyclohexyl]carbamate