CymitQuimica logo

CAS 1353973-45-1

:

N-[4-[Methyl(1-methylethyl)amino]cyclohexyl]glycine

Description:
N-[4-[Methyl(1-methylethyl)amino]cyclohexyl]glycine, identified by its CAS number 1353973-45-1, is a chemical compound that belongs to the class of amino acids and derivatives. This substance features a cyclohexyl group attached to a glycine backbone, with a methyl group and an isopropyl group on the nitrogen atom, contributing to its unique structure and properties. The presence of the cyclohexyl moiety enhances its hydrophobic characteristics, while the amino and carboxylic functional groups provide it with polar characteristics, making it amphiphilic. This compound may exhibit biological activity, potentially interacting with various receptors or enzymes, which could be of interest in pharmacological research. Its solubility and stability in different solvents can vary, influenced by the presence of the bulky cyclohexyl and isopropyl groups. Overall, N-[4-[Methyl(1-methylethyl)amino]cyclohexyl]glycine represents a complex structure that may have applications in medicinal chemistry and drug development.
Formula:C12H24N2O2
InChI:InChI=1S/C12H24N2O2/c1-9(2)14(3)11-6-4-10(5-7-11)13-8-12(15)16/h9-11,13H,4-8H2,1-3H3,(H,15,16)
InChI key:InChIKey=ACCKOIBVQPZXOE-UHFFFAOYSA-N
SMILES:N(C(C)C)(C)C1CCC(NCC(O)=O)CC1
Synonyms:
  • Glycine, N-[4-[methyl(1-methylethyl)amino]cyclohexyl]-
  • N-[4-[Methyl(1-methylethyl)amino]cyclohexyl]glycine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.