CAS 1353973-82-6
:N-Cyclopropyl-N-(phenylmethyl)-3-piperidinamine
Description:
N-Cyclopropyl-N-(phenylmethyl)-3-piperidinamine is a chemical compound characterized by its unique structure, which includes a piperidine ring substituted with a cyclopropyl group and a phenylmethyl group. This compound belongs to the class of amines and is notable for its potential biological activity, particularly in pharmacological applications. The presence of the piperidine moiety often contributes to its ability to interact with various biological targets, making it of interest in medicinal chemistry. The cyclopropyl group can influence the compound's conformational flexibility and lipophilicity, which are critical factors in drug design. Additionally, the phenylmethyl substituent may enhance the compound's binding affinity to specific receptors or enzymes. While specific physical and chemical properties such as melting point, boiling point, and solubility may vary, the compound's overall characteristics suggest potential utility in therapeutic contexts, warranting further investigation into its efficacy and safety profiles.
Formula:C15H22N2
InChI:InChI=1S/C15H22N2/c1-2-5-13(6-3-1)12-17(14-8-9-14)15-7-4-10-16-11-15/h1-3,5-6,14-16H,4,7-12H2
InChI key:InChIKey=MQWGGUMLYJKQFK-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)(C2CC2)C3CCCNC3
Synonyms:- 3-Piperidinamine, N-cyclopropyl-N-(phenylmethyl)-
- N-Cyclopropyl-N-(phenylmethyl)-3-piperidinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.