CymitQuimica logo

CAS 1353973-98-4

:

2-[Methyl[[1-(phenylmethyl)-2-pyrrolidinyl]methyl]amino]ethanol

Description:
2-[Methyl[[1-(phenylmethyl)-2-pyrrolidinyl]methyl]amino]ethanol, identified by its CAS number 1353973-98-4, is a chemical compound that features a complex structure characterized by a pyrrolidine ring and a phenylmethyl group. This compound is classified as an amino alcohol, which indicates the presence of both an amine and an alcohol functional group within its molecular framework. The presence of the pyrrolidine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological systems. The methyl and phenylmethyl substituents contribute to the compound's lipophilicity, potentially influencing its pharmacokinetic properties. Additionally, the compound's stereochemistry may play a significant role in its biological activity, making it a subject of interest for further research in drug design and synthesis. Overall, the unique structural features of this compound may offer insights into its reactivity and potential applications in various chemical and pharmaceutical contexts.
Formula:C15H24N2O
InChI:InChI=1S/C15H24N2O/c1-16(10-11-18)13-15-8-5-9-17(15)12-14-6-3-2-4-7-14/h2-4,6-7,15,18H,5,8-13H2,1H3
InChI key:InChIKey=TUQQZFCXMSRXLT-UHFFFAOYSA-N
SMILES:C(N1C(CN(CCO)C)CCC1)C2=CC=CC=C2
Synonyms:
  • Ethanol, 2-[methyl[[1-(phenylmethyl)-2-pyrrolidinyl]methyl]amino]-
  • 2-[Methyl[[1-(phenylmethyl)-2-pyrrolidinyl]methyl]amino]ethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.