CAS 1353974-04-5

1,1-Dimethylethyl 3-[(2-chloroacetyl)cyclopropylamino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 3-[(2-chloroacetyl)cyclopropylamino]-1-piperidinecarboxylate, identified by its CAS number 1353974-04-5, is a chemical compound that features a complex structure incorporating a piperidine ring, a cyclopropyl group, and a chloroacetyl moiety. This compound is characterized by its potential biological activity, which may include interactions with specific receptors or enzymes due to the presence of functional groups that can participate in hydrogen bonding and other molecular interactions. The dimethyl group contributes to steric hindrance, potentially influencing its pharmacokinetic properties. Additionally, the chloroacetyl group may enhance lipophilicity, affecting the compound's solubility and permeability. The presence of the piperidine ring suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals. Overall, the unique structural features of this compound may confer specific reactivity and biological properties, making it of interest in various fields, including drug discovery and development.

Formula: C₁₅H₂₅ClN₂O₃

InChI: InChI=1S/C15H25ClN2O3/c1-15(2,3)21-14(20)17-8-4-5-12(10-17)18(11-6-7-11)13(19)9-16/h11-12H,4-10H2,1-3H3

InChI key: InChIKey=LAYMXMYMEIJACN-UHFFFAOYSA-N

SMILES: N(C(CCl)=O)(C1CN(C(OC(C)(C)C)=O)CCC1)C2CC2

Synonyms:

• 1,1-Dimethylethyl 3-[(2-chloroacetyl)cyclopropylamino]-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 3-[(2-chloroacetyl)cyclopropylamino]-, 1,1-dimethylethyl ester