CAS 1353974-29-4
:N-Ethyl-N-[[1-(phenylmethyl)-2-pyrrolidinyl]methyl]glycine
Description:
N-Ethyl-N-[[1-(phenylmethyl)-2-pyrrolidinyl]methyl]glycine, identified by its CAS number 1353974-29-4, is a chemical compound that belongs to the class of amino acids and derivatives. It features a complex structure that includes an ethyl group, a pyrrolidine ring, and a phenylmethyl substituent, contributing to its unique properties. This compound is characterized by its potential biological activity, particularly in the context of neuropharmacology, where it may interact with neurotransmitter systems. The presence of the pyrrolidine ring suggests possible implications in central nervous system activity, while the glycine moiety indicates potential roles in receptor modulation. Its solubility and stability can vary based on environmental conditions, such as pH and temperature. As with many compounds of this nature, safety and handling precautions are essential, given the potential for biological activity. Further research is necessary to fully elucidate its pharmacological profile and potential therapeutic applications.
Formula:C16H24N2O2
InChI:InChI=1S/C16H24N2O2/c1-2-17(13-16(19)20)12-15-9-6-10-18(15)11-14-7-4-3-5-8-14/h3-5,7-8,15H,2,6,9-13H2,1H3,(H,19,20)
InChI key:InChIKey=ZLIPPJSHUBWTPD-UHFFFAOYSA-N
SMILES:C(N1C(CN(CC(O)=O)CC)CCC1)C2=CC=CC=C2
Synonyms:- Glycine, N-ethyl-N-[[1-(phenylmethyl)-2-pyrrolidinyl]methyl]-
- N-Ethyl-N-[[1-(phenylmethyl)-2-pyrrolidinyl]methyl]glycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.