CymitQuimica logo

CAS 1353974-33-0

:

2-Amino-N-(1-methylethyl)-N-[[1-(phenylmethyl)-2-piperidinyl]methyl]acetamide

Description:
2-Amino-N-(1-methylethyl)-N-[[1-(phenylmethyl)-2-piperidinyl]methyl]acetamide, identified by its CAS number 1353974-33-0, is a synthetic organic compound characterized by its complex molecular structure, which includes an acetamide functional group, an amino group, and a piperidine ring. This compound is typically classified as a pharmaceutical intermediate or a potential drug candidate, often explored for its biological activity. Its structure suggests it may interact with various biological targets, potentially influencing neurotransmitter systems. The presence of both aliphatic and aromatic components in its structure may contribute to its lipophilicity and solubility properties, which are crucial for its pharmacokinetic profile. Additionally, the compound's stereochemistry, particularly the presence of chiral centers, can significantly affect its biological activity and interactions with receptors. As with many compounds in medicinal chemistry, understanding its stability, reactivity, and potential toxicity is essential for further development and application in therapeutic contexts.
Formula:C18H29N3O
InChI:InChI=1S/C18H29N3O/c1-15(2)21(18(22)12-19)14-17-10-6-7-11-20(17)13-16-8-4-3-5-9-16/h3-5,8-9,15,17H,6-7,10-14,19H2,1-2H3
InChI key:InChIKey=YNOIEABWRWTEAQ-UHFFFAOYSA-N
SMILES:C(N(C(CN)=O)C(C)C)C1N(CC2=CC=CC=C2)CCCC1
Synonyms:
  • 2-Amino-N-(1-methylethyl)-N-[[1-(phenylmethyl)-2-piperidinyl]methyl]acetamide
  • Acetamide, 2-amino-N-(1-methylethyl)-N-[[1-(phenylmethyl)-2-piperidinyl]methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.