CAS 1353974-45-4

N-[(1-Acetyl-3-pyrrolidinyl)methyl]-N-ethylglycine

Description:

N-[(1-Acetyl-3-pyrrolidinyl)methyl]-N-ethylglycine, identified by its CAS number 1353974-45-4, is a chemical compound that features a pyrrolidine ring, an acetyl group, and an ethylglycine moiety. This compound is characterized by its structural complexity, which includes a nitrogen-containing heterocyclic ring and an amino acid derivative. The presence of the acetyl group suggests potential reactivity and the ability to participate in various chemical reactions, such as acylation or amidation. The pyrrolidine ring contributes to the compound's steric and electronic properties, influencing its interactions with biological systems. Additionally, the ethylglycine component may impart specific solubility characteristics and biological activity. While detailed pharmacological data may not be widely available, compounds of this nature are often investigated for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or metabolic pathways. Overall, the unique structural features of N-[(1-Acetyl-3-pyrrolidinyl)methyl]-N-ethylglycine suggest it may have interesting chemical and biological properties worthy of further exploration.

Formula: C₁₁H₂₀N₂O₃

InChI: InChI=1S/C11H20N2O3/c1-3-12(8-11(15)16)6-10-4-5-13(7-10)9(2)14/h10H,3-8H2,1-2H3,(H,15,16)

InChI key: InChIKey=CBMPEGXODUCPBZ-UHFFFAOYSA-N

SMILES: C(N(CC(O)=O)CC)C1CN(C(C)=O)CC1

Synonyms:

• Glycine, N-[(1-acetyl-3-pyrrolidinyl)methyl]-N-ethyl-
• N-[(1-Acetyl-3-pyrrolidinyl)methyl]-N-ethylglycine