CAS 1353974-48-7

1-[4-[[(2-Hydroxyethyl)methylamino]methyl]-1-piperidinyl]ethanone

Description:

1-[4-[[(2-Hydroxyethyl)methylamino]methyl]-1-piperidinyl]ethanone, identified by its CAS number 1353974-48-7, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a ketone functional group. This compound features a hydroxyethyl group that is substituted with a methylamino moiety, contributing to its potential biological activity. The presence of the piperidine ring suggests that it may exhibit properties similar to other piperidine derivatives, which are often explored for their pharmacological effects. The ketone functional group can participate in various chemical reactions, including nucleophilic additions and reductions. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could influence its interaction with biological targets. However, specific details regarding its solubility, stability, and reactivity would require further investigation through experimental studies. Overall, this compound represents a unique structure that may have implications in various chemical and biological applications.

Formula: C₁₁H₂₂N₂O₂

InChI: InChI=1S/C11H22N2O2/c1-10(15)13-5-3-11(4-6-13)9-12(2)7-8-14/h11,14H,3-9H2,1-2H3

InChI key: InChIKey=HIFINWUXIPEGPG-UHFFFAOYSA-N

SMILES: C(N(CCO)C)C1CCN(C(C)=O)CC1

Synonyms:

• 1-[4-[[(2-Hydroxyethyl)methylamino]methyl]-1-piperidinyl]ethanone
• Ethanone, 1-[4-[[(2-hydroxyethyl)methylamino]methyl]-1-piperidinyl]-