CAS 1353974-52-3
:1-[3-[(2-Hydroxyethyl)methylamino]-1-pyrrolidinyl]ethanone
Description:
1-[3-[(2-Hydroxyethyl)methylamino]-1-pyrrolidinyl]ethanone, with the CAS number 1353974-52-3, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and an ethanone functional group. This substance features a hydroxyl group and a methylamino group, contributing to its potential solubility in polar solvents. The presence of the pyrrolidine ring suggests that it may exhibit properties typical of cyclic amines, such as basicity and the ability to participate in hydrogen bonding. The hydroxyl group enhances its hydrophilicity, making it more reactive in biological systems. This compound may be of interest in medicinal chemistry due to its structural features, which could influence its pharmacological activity. Additionally, its unique combination of functional groups may allow for interactions with various biological targets, potentially leading to applications in drug development or therapeutic agents. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C9H18N2O2
InChI:InChI=1S/C9H18N2O2/c1-8(13)11-4-3-9(7-11)10(2)5-6-12/h9,12H,3-7H2,1-2H3
InChI key:InChIKey=HFACMCXOPRTYAZ-UHFFFAOYSA-N
SMILES:N(CCO)(C)C1CN(C(C)=O)CC1
Synonyms:- Ethanone, 1-[3-[(2-hydroxyethyl)methylamino]-1-pyrrolidinyl]-
- 1-[3-[(2-Hydroxyethyl)methylamino]-1-pyrrolidinyl]ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.