CAS 1353974-53-4
:1-[2-[[(2-Hydroxyethyl)(1-methylethyl)amino]methyl]-1-piperidinyl]ethanone
Description:
1-[2-[[(2-Hydroxyethyl)(1-methylethyl)amino]methyl]-1-piperidinyl]ethanone, with the CAS number 1353974-53-4, is a chemical compound characterized by its complex structure, which includes a piperidine ring and an ethanone moiety. This compound features a hydroxyethyl group and an isopropylamine substituent, contributing to its potential biological activity. It is typically classified as an organic amine and may exhibit properties such as solubility in polar solvents due to the presence of hydroxyl and amine functional groups. The piperidine ring can influence its pharmacological properties, making it of interest in medicinal chemistry. The compound's structure suggests potential interactions with biological targets, which may be relevant in drug development. However, specific data regarding its reactivity, stability, and biological effects would require further investigation through experimental studies. Overall, this compound represents a class of molecules that may have applications in pharmaceuticals or related fields.
Formula:C13H26N2O2
InChI:InChI=1S/C13H26N2O2/c1-11(2)14(8-9-16)10-13-6-4-5-7-15(13)12(3)17/h11,13,16H,4-10H2,1-3H3
InChI key:InChIKey=SYJMBZSGIUGZJF-UHFFFAOYSA-N
SMILES:C(N(CCO)C(C)C)C1N(C(C)=O)CCCC1
Synonyms:- Ethanone, 1-[2-[[(2-hydroxyethyl)(1-methylethyl)amino]methyl]-1-piperidinyl]-
- 1-[2-[[(2-Hydroxyethyl)(1-methylethyl)amino]methyl]-1-piperidinyl]ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.