CAS 1353974-61-4

1,1-Dimethylethyl N-[1-(2-aminoethyl)-3-pyrrolidinyl]-N-ethylcarbamate

Description:

1,1-Dimethylethyl N-[1-(2-aminoethyl)-3-pyrrolidinyl]-N-ethylcarbamate, identified by its CAS number 1353974-61-4, is a chemical compound that belongs to the class of carbamates. This substance features a complex molecular structure characterized by the presence of a dimethyl group, a pyrrolidine ring, and an aminoethyl side chain. The carbamate functional group is known for its role in various biological activities, often acting as a substrate or inhibitor in enzymatic reactions. The compound may exhibit properties such as moderate solubility in polar solvents, and its stability can be influenced by environmental factors like pH and temperature. Additionally, due to its structural components, it may interact with biological systems, potentially serving as a pharmacological agent. However, specific data regarding its toxicity, bioactivity, and applications would require further investigation through experimental studies and literature reviews. Overall, this compound represents a unique structure with potential implications in medicinal chemistry and pharmacology.

Formula: C₁₃H₂₇N₃O₂

InChI: InChI=1S/C13H27N3O2/c1-5-16(12(17)18-13(2,3)4)11-6-8-15(10-11)9-7-14/h11H,5-10,14H2,1-4H3

InChI key: InChIKey=FJOPYTXBOGFHFH-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)(CC)C1CN(CCN)CC1

Synonyms:

• 1,1-Dimethylethyl N-[1-(2-aminoethyl)-3-pyrrolidinyl]-N-ethylcarbamate
• Carbamic acid, N-[1-(2-aminoethyl)-3-pyrrolidinyl]-N-ethyl-, 1,1-dimethylethyl ester