CAS 1353975-13-9
:3-[(1-Methylethyl)(phenylmethyl)amino]-1-pyrrolidineethanol
Description:
3-[(1-Methylethyl)(phenylmethyl)amino]-1-pyrrolidineethanol, identified by its CAS number 1353975-13-9, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and an ethanol moiety. This compound features a tertiary amine due to the presence of the isopropyl and benzyl groups attached to the nitrogen atom, contributing to its potential biological activity. The presence of the hydroxyl group in the ethanol portion suggests that it may exhibit polar characteristics, influencing its solubility in various solvents. Additionally, the molecular structure indicates that it may engage in hydrogen bonding, which can affect its interactions with biological targets. The compound's unique arrangement of functional groups may also impart specific pharmacological properties, making it of interest in medicinal chemistry. However, detailed studies would be necessary to fully elucidate its properties, including its reactivity, stability, and potential applications in pharmaceuticals or other fields.
Formula:C16H26N2O
InChI:InChI=1S/C16H26N2O/c1-14(2)18(12-15-6-4-3-5-7-15)16-8-9-17(13-16)10-11-19/h3-7,14,16,19H,8-13H2,1-2H3
InChI key:InChIKey=RWTSLPHCOFWTFX-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)(C(C)C)C2CN(CCO)CC2
Synonyms:- 3-[(1-Methylethyl)(phenylmethyl)amino]-1-pyrrolidineethanol
- 1-Pyrrolidineethanol, 3-[(1-methylethyl)(phenylmethyl)amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.