CAS 1353975-26-4

3-[[(1-Methylethyl)(phenylmethyl)amino]methyl]-1-pyrrolidineethanamine

Description:

3-[[(1-Methylethyl)(phenylmethyl)amino]methyl]-1-pyrrolidineethanamine, with the CAS number 1353975-26-4, is a chemical compound that belongs to the class of amines. It features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and is characterized by the presence of a branched alkyl group and a phenylmethyl substituent. This compound exhibits properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of multiple functional groups suggests potential for diverse interactions in biological systems, making it of interest in medicinal chemistry. Its structural complexity may also indicate potential for specific binding interactions with biological targets. However, detailed studies on its pharmacological properties, toxicity, and environmental impact would be necessary to fully understand its characteristics and applications. As with any chemical substance, proper handling and safety protocols should be observed due to the potential for biological activity.

Formula: C₁₇H₂₉N₃

InChI: InChI=1S/C17H29N3/c1-15(2)20(13-16-6-4-3-5-7-16)14-17-8-10-19(12-17)11-9-18/h3-7,15,17H,8-14,18H2,1-2H3

InChI key: InChIKey=SNZGINFJOQZXQL-UHFFFAOYSA-N

SMILES: C(N(CC1=CC=CC=C1)C(C)C)C2CN(CCN)CC2

Synonyms:

• 3-[[(1-Methylethyl)(phenylmethyl)amino]methyl]-1-pyrrolidineethanamine
• 1-Pyrrolidineethanamine, 3-[[(1-methylethyl)(phenylmethyl)amino]methyl]-