CAS 1353975-68-4
:1,1-Dimethylethyl N-[1-(2-aminoethyl)-3-piperidinyl]-N-methylcarbamate
Description:
1,1-Dimethylethyl N-[1-(2-aminoethyl)-3-piperidinyl]-N-methylcarbamate, identified by its CAS number 1353975-68-4, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by a dimethyl group attached to a tert-butyl moiety, which contributes to its steric bulk. The presence of a piperidine ring indicates potential pharmacological activity, as piperidine derivatives are often associated with various biological effects. The aminoethyl side chain suggests that the compound may interact with biological systems, possibly influencing neurotransmitter pathways. Its carbamate functional group is known for its reactivity and ability to form hydrogen bonds, which can enhance solubility and bioavailability. Additionally, the compound's molecular structure may confer specific properties such as lipophilicity or hydrophilicity, influencing its behavior in biological and environmental contexts. Overall, this compound's unique characteristics make it of interest in medicinal chemistry and pharmacology, although specific applications would depend on further research and development.
Formula:C13H27N3O2
InChI:InChI=1S/C13H27N3O2/c1-13(2,3)18-12(17)15(4)11-6-5-8-16(10-11)9-7-14/h11H,5-10,14H2,1-4H3
InChI key:InChIKey=SVGVNEVPPUPTGE-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)(C)C1CN(CCN)CCC1
Synonyms:- Carbamic acid, N-[1-(2-aminoethyl)-3-piperidinyl]-N-methyl-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl N-[1-(2-aminoethyl)-3-piperidinyl]-N-methylcarbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.