CymitQuimica logo

CAS 1353975-72-0

:

2-Chloro-N-ethyl-N-[1-(phenylmethyl)-3-piperidinyl]acetamide

Description:
2-Chloro-N-ethyl-N-[1-(phenylmethyl)-3-piperidinyl]acetamide is a chemical compound characterized by its unique structural features, which include a chloro substituent, an ethyl group, and a piperidine ring. This compound belongs to the class of acetamides and is notable for its potential pharmacological properties. The presence of the piperidine moiety suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The chloro group may influence the compound's reactivity and solubility, while the phenylmethyl group can enhance lipophilicity, potentially affecting its bioavailability. The compound's molecular structure indicates it may participate in various chemical reactions, including nucleophilic substitutions and acylation processes. As with many synthetic organic compounds, its safety profile, including toxicity and environmental impact, would need to be assessed through appropriate studies. Overall, 2-Chloro-N-ethyl-N-[1-(phenylmethyl)-3-piperidinyl]acetamide represents a complex molecule with potential applications in drug development and research.
Formula:C16H23ClN2O
InChI:InChI=1S/C16H23ClN2O/c1-2-19(16(20)11-17)15-9-6-10-18(13-15)12-14-7-4-3-5-8-14/h3-5,7-8,15H,2,6,9-13H2,1H3
InChI key:InChIKey=IATOYQCUOIQASY-UHFFFAOYSA-N
SMILES:N(C(CCl)=O)(CC)C1CN(CC2=CC=CC=C2)CCC1
Synonyms:
  • Acetamide, 2-chloro-N-ethyl-N-[1-(phenylmethyl)-3-piperidinyl]-
  • 2-Chloro-N-ethyl-N-[1-(phenylmethyl)-3-piperidinyl]acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.