CAS 1353975-80-0

2-Amino-N-[4-[ethyl(phenylmethyl)amino]cyclohexyl]acetamide

Description:

2-Amino-N-[4-[ethyl(phenylmethyl)amino]cyclohexyl]acetamide is a chemical compound characterized by its complex structure, which includes an amino group, an acetamide moiety, and a cyclohexyl ring substituted with an ethyl and phenylmethyl group. This compound is likely to exhibit properties typical of amines and amides, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the amino and acetamide functional groups. The cyclohexyl ring may contribute to its hydrophobic characteristics, influencing its overall solubility and reactivity. Additionally, the presence of the ethyl and phenylmethyl substituents can affect the compound's biological activity, potentially making it relevant in medicinal chemistry. The specific interactions and stability of this compound would depend on its molecular conformation and the steric effects of its substituents. As with many organic compounds, its behavior in various chemical environments would be influenced by factors such as pH, temperature, and the presence of other reactive species.

Formula: C₁₇H₂₇N₃O

InChI: InChI=1S/C17H27N3O/c1-2-20(13-14-6-4-3-5-7-14)16-10-8-15(9-11-16)19-17(21)12-18/h3-7,15-16H,2,8-13,18H2,1H3,(H,19,21)

InChI key: InChIKey=DMSWSUAKELNOBM-UHFFFAOYSA-N

SMILES: N(CC1=CC=CC=C1)(CC)C2CCC(NC(CN)=O)CC2

Synonyms:

• Acetamide, 2-amino-N-[4-[ethyl(phenylmethyl)amino]cyclohexyl]-
• 2-Amino-N-[4-[ethyl(phenylmethyl)amino]cyclohexyl]acetamide