CAS 1353976-38-1
:2-Amino-N-[(2,3-dichlorophenyl)methyl]-N-ethylacetamide
Description:
2-Amino-N-[(2,3-dichlorophenyl)methyl]-N-ethylacetamide is a chemical compound characterized by its amide functional group, which is indicative of its potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding, enhancing its solubility in polar solvents. The dichlorophenyl moiety contributes to its hydrophobic characteristics and may influence its interaction with biological targets. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic ring and the presence of chlorine substituents, which can affect its pharmacokinetic properties. Additionally, the ethyl group attached to the nitrogen atom may enhance its steric profile, potentially impacting its binding affinity to specific receptors or enzymes. The compound's structure suggests it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. However, specific biological activity, toxicity, and environmental impact would require further investigation through experimental studies.
Formula:C11H14Cl2N2O
InChI:InChI=1S/C11H14Cl2N2O/c1-2-15(10(16)6-14)7-8-4-3-5-9(12)11(8)13/h3-5H,2,6-7,14H2,1H3
InChI key:InChIKey=SBGHTJLQZLZOBP-UHFFFAOYSA-N
SMILES:C(N(C(CN)=O)CC)C1=C(Cl)C(Cl)=CC=C1
Synonyms:- Acetamide, 2-amino-N-[(2,3-dichlorophenyl)methyl]-N-ethyl-
- 2-Amino-N-[(2,3-dichlorophenyl)methyl]-N-ethylacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.