CymitQuimica logo

CAS 1353976-70-1

:

2-Chloro-N-ethyl-N-(1-methyl-3-pyrrolidinyl)acetamide

Description:
2-Chloro-N-ethyl-N-(1-methyl-3-pyrrolidinyl)acetamide is a chemical compound characterized by its unique structure, which includes a chloro substituent and a pyrrolidine ring. This compound features an acetamide functional group, indicating it has both amine and carbonyl characteristics. The presence of the chloro group suggests potential reactivity, particularly in nucleophilic substitution reactions. The pyrrolidine moiety contributes to the compound's cyclic structure, which can influence its steric and electronic properties, potentially affecting its biological activity. This compound may exhibit specific pharmacological effects due to its structural features, making it of interest in medicinal chemistry. Additionally, its solubility and stability can vary based on environmental conditions, such as pH and temperature. As with many organic compounds, safety and handling precautions are essential, as it may pose health risks if not managed properly. Overall, 2-Chloro-N-ethyl-N-(1-methyl-3-pyrrolidinyl)acetamide represents a complex molecule with potential applications in various fields, including pharmaceuticals and chemical research.
Formula:C9H17ClN2O
InChI:InChI=1S/C9H17ClN2O/c1-3-12(9(13)6-10)8-4-5-11(2)7-8/h8H,3-7H2,1-2H3
InChI key:InChIKey=IKPKGEJKIGCLCP-UHFFFAOYSA-N
SMILES:N(C(CCl)=O)(CC)C1CN(C)CC1
Synonyms:
  • 2-Chloro-N-ethyl-N-(1-methyl-3-pyrrolidinyl)acetamide
  • Acetamide, 2-chloro-N-ethyl-N-(1-methyl-3-pyrrolidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.