CAS 1353977-05-5
:N-Cyclopropyl-N-[1-(2-hydroxyethyl)-3-pyrrolidinyl]acetamide
Description:
N-Cyclopropyl-N-[1-(2-hydroxyethyl)-3-pyrrolidinyl]acetamide, identified by its CAS number 1353977-05-5, is a chemical compound that belongs to the class of amides. This substance features a cyclopropyl group and a pyrrolidine ring, which contribute to its unique structural and functional properties. The presence of a hydroxyethyl substituent enhances its potential for hydrogen bonding, influencing its solubility and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The specific interactions of this compound with biological targets can vary, depending on its conformation and the functional groups present. Additionally, its molecular structure suggests potential applications in drug development, particularly in areas targeting neurological or psychological conditions, given the pyrrolidine moiety's common association with such therapeutic areas. As with any chemical substance, safety and handling precautions should be observed, and its properties should be thoroughly evaluated in a laboratory setting.
Formula:C11H20N2O2
InChI:InChI=1S/C11H20N2O2/c1-9(15)13(10-2-3-10)11-4-5-12(8-11)6-7-14/h10-11,14H,2-8H2,1H3
InChI key:InChIKey=PXVPWQBQOYDPGT-UHFFFAOYSA-N
SMILES:N(C(C)=O)(C1CN(CCO)CC1)C2CC2
Synonyms:- N-Cyclopropyl-N-[1-(2-hydroxyethyl)-3-pyrrolidinyl]acetamide
- Acetamide, N-cyclopropyl-N-[1-(2-hydroxyethyl)-3-pyrrolidinyl]-
- N-Cyclopropyl-N-[1-(2-hydroxy-ethyl)-pyrrolidin-3-yl]-acetaMide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.