CAS 1353977-07-7
:2-Chloro-N-cyclopropyl-N-[(2,3-dihydro-1,4-benzodioxin-2-yl)methyl]acetamide
Description:
2-Chloro-N-cyclopropyl-N-[(2,3-dihydro-1,4-benzodioxin-2-yl)methyl]acetamide is a synthetic organic compound characterized by its complex molecular structure, which includes a chloro group, a cyclopropyl moiety, and a benzodioxin ring system. The presence of the chloro substituent suggests potential reactivity, particularly in nucleophilic substitution reactions. The cyclopropyl group contributes to the compound's rigidity and may influence its biological activity by affecting the conformation of the molecule. The benzodioxin component is known for its potential pharmacological properties, often associated with various biological activities. This compound may exhibit solubility in organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. Additionally, the presence of functional groups like the acetamide suggests potential for hydrogen bonding, which can affect its interactions with biological targets. Overall, this compound's unique structural features may render it of interest in medicinal chemistry and drug development, although specific biological activities would require empirical investigation.
Formula:C14H16ClNO3
InChI:InChI=1S/C14H16ClNO3/c15-7-14(17)16(10-5-6-10)8-11-9-18-12-3-1-2-4-13(12)19-11/h1-4,10-11H,5-9H2
InChI key:InChIKey=XOULMTAOAJZLQM-UHFFFAOYSA-N
SMILES:N(CC1OC=2C(OC1)=CC=CC2)(C(CCl)=O)C3CC3
Synonyms:- 2-Chloro-N-cyclopropyl-N-[(2,3-dihydro-1,4-benzodioxin-2-yl)methyl]acetamide
- Acetamide, 2-chloro-N-cyclopropyl-N-[(2,3-dihydro-1,4-benzodioxin-2-yl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.