CAS 1353977-17-9

2-Chloro-N-ethyl-N-[(3-nitrophenyl)methyl]acetamide

Description:

2-Chloro-N-ethyl-N-[(3-nitrophenyl)methyl]acetamide is a chemical compound characterized by its specific functional groups and structural features. It contains a chloro group, an ethyl substituent, and a nitrophenyl moiety, which contribute to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the acetamide functional group suggests that it may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can influence its solubility and boiling point. The nitro group is known for its electron-withdrawing effects, which can enhance the compound's reactivity in electrophilic substitution reactions. Additionally, the compound's molecular structure may impart specific biological activities, making it of interest for further research in medicinal chemistry. Safety and handling precautions should be observed due to the presence of chlorine and nitro groups, which can pose health and environmental risks. Overall, 2-Chloro-N-ethyl-N-[(3-nitrophenyl)methyl]acetamide represents a complex organic molecule with diverse potential applications.

Formula: C₁₁H₁₃ClN₂O₃

InChI: InChI=1S/C11H13ClN2O3/c1-2-13(11(15)7-12)8-9-4-3-5-10(6-9)14(16)17/h3-6H,2,7-8H2,1H3

InChI key: InChIKey=DYYASEKEZREXGR-UHFFFAOYSA-N

SMILES: C(N(C(CCl)=O)CC)C1=CC(N(=O)=O)=CC=C1

Synonyms:

• Acetamide, 2-chloro-N-ethyl-N-[(3-nitrophenyl)methyl]-
• 2-Chloro-N-ethyl-N-[(3-nitrophenyl)methyl]acetamide