CAS 1353977-53-3
:2-Amino-N-[(2-bromo-4-pyridinyl)methyl]-N-(1-methylethyl)acetamide
Description:
2-Amino-N-[(2-bromo-4-pyridinyl)methyl]-N-(1-methylethyl)acetamide is a chemical compound characterized by its complex structure, which includes an amino group, a pyridine ring, and an acetamide moiety. The presence of the bromine atom on the pyridine ring contributes to its reactivity and potential biological activity. This compound is likely to exhibit polar characteristics due to the amino and acetamide functional groups, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's solubility, stability, and reactivity can be influenced by the substituents on the pyridine ring and the isopropyl group attached to the acetamide. Additionally, the presence of the bromine atom may enhance its lipophilicity, affecting its pharmacokinetic properties. Overall, this compound represents a class of molecules that may have significant implications in drug discovery and development.
Formula:C11H16BrN3O
InChI:InChI=1S/C11H16BrN3O/c1-8(2)15(11(16)6-13)7-9-3-4-14-10(12)5-9/h3-5,8H,6-7,13H2,1-2H3
InChI key:InChIKey=HXZREFKSQROHLE-UHFFFAOYSA-N
SMILES:N(CC=1C=C(Br)N=CC1)(C(CN)=O)C(C)C
Synonyms:- 2-Amino-N-[(2-bromo-4-pyridinyl)methyl]-N-(1-methylethyl)acetamide
- Acetamide, 2-amino-N-[(2-bromo-4-pyridinyl)methyl]-N-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.