CAS 1353977-76-0
:2-Chloro-N-methyl-N-[1-(2-pyridinyl)ethyl]acetamide
Description:
2-Chloro-N-methyl-N-[1-(2-pyridinyl)ethyl]acetamide is a chemical compound characterized by its unique structure, which includes a chloro substituent, a methyl group, and a pyridine ring. This compound belongs to the class of acetamides and features a nitrogen atom bonded to both a methyl group and a pyridinyl group, contributing to its potential biological activity. The presence of the chloro group enhances its reactivity and may influence its interaction with biological targets. Typically, compounds of this nature are studied for their pharmacological properties, including potential applications in medicinal chemistry. The molecular structure suggests that it may exhibit polar characteristics, which can affect its solubility and bioavailability. Additionally, the pyridine moiety may impart specific interactions with receptors or enzymes, making it a candidate for further research in drug development. Safety and handling precautions are essential when working with this compound, as with many chemical substances, due to potential toxicity or reactivity.
Formula:C10H13ClN2O
InChI:InChI=1S/C10H13ClN2O/c1-8(13(2)10(14)7-11)9-5-3-4-6-12-9/h3-6,8H,7H2,1-2H3
InChI key:InChIKey=ONQPGWHXXRKVNN-UHFFFAOYSA-N
SMILES:C(N(C(CCl)=O)C)(C)C1=CC=CC=N1
Synonyms:- Acetamide, 2-chloro-N-methyl-N-[1-(2-pyridinyl)ethyl]-
- 2-Chloro-N-methyl-N-[1-(2-pyridinyl)ethyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.