CymitQuimica logo

CAS 1353977-80-6

:

2-Amino-N-[(6-chloro-3-pyridinyl)methyl]-N-methylacetamide

Description:
2-Amino-N-[(6-chloro-3-pyridinyl)methyl]-N-methylacetamide is a chemical compound characterized by its specific functional groups and structural features. It contains an amino group (-NH2), a methylacetamide moiety, and a pyridine ring substituted with a chlorine atom at the 6-position. The presence of the pyridine ring contributes to its potential biological activity, as pyridine derivatives are often found in pharmaceuticals. The compound's molecular structure suggests it may exhibit polar characteristics due to the amino and acetamide groups, which can influence its solubility and reactivity. Additionally, the chlorine substituent can affect the compound's electronic properties and steric hindrance, potentially impacting its interaction with biological targets. The compound's CAS number, 1353977-80-6, allows for precise identification in chemical databases, facilitating research and development in medicinal chemistry and related fields. Overall, this compound's unique structure may render it of interest for further studies in drug discovery and development.
Formula:C9H12ClN3O
InChI:InChI=1S/C9H12ClN3O/c1-13(9(14)4-11)6-7-2-3-8(10)12-5-7/h2-3,5H,4,6,11H2,1H3
InChI key:InChIKey=ANPROIXNMUTDFO-UHFFFAOYSA-N
SMILES:C(N(C(CN)=O)C)C=1C=CC(Cl)=NC1
Synonyms:
  • 2-Amino-N-[(6-chloro-3-pyridinyl)methyl]-N-methylacetamide
  • Acetamide, 2-amino-N-[(6-chloro-3-pyridinyl)methyl]-N-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.