CAS 1353977-83-9
:2-Amino-1-[3-[cyclopropyl(phenylmethyl)amino]-1-piperidinyl]ethanone
Description:
2-Amino-1-[3-[cyclopropyl(phenylmethyl)amino]-1-piperidinyl]ethanone, with the CAS number 1353977-83-9, is a synthetic organic compound characterized by its complex structure, which includes an amino group, a piperidine ring, and a cyclopropyl group attached to a phenylmethyl moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the piperidine ring contributes to its potential pharmacological activity, making it of interest in medicinal chemistry. Its structural features suggest it may interact with various biological targets, potentially influencing neurotransmitter systems. The compound's stability, reactivity, and biological activity would depend on factors such as pH, temperature, and the presence of other chemical species. As with many synthetic compounds, safety and handling precautions are essential, given the potential for toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and applications in research or therapeutic contexts.
Formula:C17H25N3O
InChI:InChI=1S/C17H25N3O/c18-11-17(21)19-10-4-7-16(13-19)20(15-8-9-15)12-14-5-2-1-3-6-14/h1-3,5-6,15-16H,4,7-13,18H2
InChI key:InChIKey=SXQUPPKJTQSBEQ-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)(C2CN(C(CN)=O)CCC2)C3CC3
Synonyms:- Ethanone, 2-amino-1-[3-[cyclopropyl(phenylmethyl)amino]-1-piperidinyl]-
- 2-Amino-1-[3-[cyclopropyl(phenylmethyl)amino]-1-piperidinyl]ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.