CAS 1353977-87-3
:2-Amino-N-[(2-bromo-4-pyridinyl)methyl]-N-cyclopropylacetamide
Description:
2-Amino-N-[(2-bromo-4-pyridinyl)methyl]-N-cyclopropylacetamide is a chemical compound characterized by its unique structural features, which include an amino group, a cyclopropyl group, and a pyridine ring substituted with a bromine atom. This compound belongs to the class of acetamides and exhibits properties typical of amines and heterocyclic compounds. The presence of the bromine atom enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The cyclopropyl moiety contributes to its three-dimensional structure, potentially influencing its biological activity and interaction with target molecules. Additionally, the pyridine ring may impart specific electronic properties, affecting the compound's solubility and stability in different solvents. Overall, this compound's unique combination of functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Further studies would be necessary to elucidate its full range of properties and potential uses.
Formula:C11H14BrN3O
InChI:InChI=1S/C11H14BrN3O/c12-10-5-8(3-4-14-10)7-15(9-1-2-9)11(16)6-13/h3-5,9H,1-2,6-7,13H2
InChI key:InChIKey=YZHGSPJKFMVICB-UHFFFAOYSA-N
SMILES:N(CC=1C=C(Br)N=CC1)(C(CN)=O)C2CC2
Synonyms:- Acetamide, 2-amino-N-[(2-bromo-4-pyridinyl)methyl]-N-cyclopropyl-
- 2-Amino-N-[(2-bromo-4-pyridinyl)methyl]-N-cyclopropylacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.