CAS 1353978-00-3
:2-Chloro-N-[(2-chloro-6-fluorophenyl)methyl]-N-ethylacetamide
Description:
2-Chloro-N-[(2-chloro-6-fluorophenyl)methyl]-N-ethylacetamide is a chemical compound characterized by its specific functional groups and structural features. It contains a chloro substituent and a fluorophenyl moiety, which contribute to its unique chemical reactivity and potential biological activity. The presence of the acetamide functional group indicates that it may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can influence its solubility and interaction with biological targets. The ethyl group attached to the nitrogen atom suggests that it may have moderate lipophilicity, potentially affecting its pharmacokinetic properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural similarities to other bioactive molecules. Additionally, the presence of halogens (chlorine and fluorine) often enhances the compound's stability and can modulate its biological activity. Overall, the characteristics of this compound make it a subject of interest for further research in various chemical and biological applications.
Formula:C11H12Cl2FNO
InChI:InChI=1S/C11H12Cl2FNO/c1-2-15(11(16)6-12)7-8-9(13)4-3-5-10(8)14/h3-5H,2,6-7H2,1H3
InChI key:InChIKey=JUVRWAMSOVBGBD-UHFFFAOYSA-N
SMILES:C(N(C(CCl)=O)CC)C1=C(Cl)C=CC=C1F
Synonyms:- Acetamide, 2-chloro-N-[(2-chloro-6-fluorophenyl)methyl]-N-ethyl-
- 2-Chloro-N-[(2-chloro-6-fluorophenyl)methyl]-N-ethylacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.