CAS 1353978-06-9

2-Amino-N-[(2,6-dichlorophenyl)methyl]acetamide

Description:

2-Amino-N-[(2,6-dichlorophenyl)methyl]acetamide is a chemical compound characterized by its amide functional group, which features an amino group (-NH2) and an acetamide moiety. The presence of the 2,6-dichlorophenyl group indicates that the compound has two chlorine substituents on the phenyl ring, which can influence its biological activity and solubility. This compound is likely to exhibit polar characteristics due to the amino and acetamide groups, making it soluble in polar solvents. Its structure suggests potential applications in medicinal chemistry, possibly as a pharmaceutical intermediate or active ingredient, given the presence of the amino and aromatic functionalities that are often associated with bioactive compounds. Additionally, the dichlorophenyl group may enhance the compound's lipophilicity, affecting its pharmacokinetic properties. As with many amides, it may also participate in hydrogen bonding, influencing its interactions in biological systems. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogenated groups.

Formula: C₉H₁₀Cl₂N₂O

InChI: InChI=1S/C9H10Cl2N2O/c10-7-2-1-3-8(11)6(7)5-13-9(14)4-12/h1-3H,4-5,12H2,(H,13,14)

InChI key: InChIKey=BSJKVMBUPPKGBW-UHFFFAOYSA-N

SMILES: C(NC(CN)=O)C1=C(Cl)C=CC=C1Cl

Synonyms:

• 2-Amino-N-[(2,6-dichlorophenyl)methyl]acetamide
• Acetamide, 2-amino-N-[(2,6-dichlorophenyl)methyl]-