CAS 1353978-10-5

2-[[1-(Phenylmethyl)-2-pyrrolidinyl]methoxy]acetic acid

Description:

2-[[1-(Phenylmethyl)-2-pyrrolidinyl]methoxy]acetic acid, identified by its CAS number 1353978-10-5, is a chemical compound that features a complex structure incorporating a pyrrolidine ring and a phenylmethyl group. This compound is characterized by its ability to interact with biological systems, potentially influencing neurotransmitter pathways due to the presence of the pyrrolidine moiety, which is often associated with psychoactive properties. The methoxy and acetic acid functional groups contribute to its solubility and reactivity, making it suitable for various applications in medicinal chemistry. Its molecular structure suggests potential for forming hydrogen bonds, which may enhance its interactions with biological targets. Additionally, the presence of the phenyl group may provide lipophilicity, influencing its pharmacokinetic properties. Overall, this compound's unique combination of functional groups and structural features positions it as a candidate for further research in drug development and therapeutic applications.

Formula: C₁₄H₁₉NO₃

InChI: InChI=1S/C14H19NO3/c16-14(17)11-18-10-13-7-4-8-15(13)9-12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11H2,(H,16,17)

InChI key: InChIKey=YKOIUYSMMLNURB-UHFFFAOYSA-N

SMILES: C(N1C(COCC(O)=O)CCC1)C2=CC=CC=C2

Synonyms:

• Acetic acid, 2-[[1-(phenylmethyl)-2-pyrrolidinyl]methoxy]-
• 2-[[1-(Phenylmethyl)-2-pyrrolidinyl]methoxy]acetic acid