CAS 1353978-17-2
:N-(1-Methylethyl)-N-[2-oxo-2-(2-thienyl)ethyl]glycine
Description:
N-(1-Methylethyl)-N-[2-oxo-2-(2-thienyl)ethyl]glycine, identified by its CAS number 1353978-17-2, is a chemical compound that features a glycine backbone modified with specific substituents. This compound contains a thienyl group, which is a five-membered aromatic ring containing sulfur, contributing to its unique chemical properties. The presence of the 2-oxo group indicates that it has a carbonyl functionality, which can participate in various chemical reactions, including nucleophilic addition and condensation reactions. The isopropyl group (1-methylethyl) attached to the nitrogen atoms suggests that the compound may exhibit steric hindrance, potentially influencing its reactivity and interactions with biological targets. Overall, this compound may possess interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its structural characteristics suggest potential applications in drug development, particularly in areas targeting specific biological pathways or mechanisms. However, detailed studies would be necessary to fully elucidate its biological activity and therapeutic potential.
Formula:C11H15NO3S
InChI:InChI=1S/C11H15NO3S/c1-8(2)12(7-11(14)15)6-9(13)10-4-3-5-16-10/h3-5,8H,6-7H2,1-2H3,(H,14,15)
InChI key:InChIKey=UNEYFTHAYZYUAK-UHFFFAOYSA-N
SMILES:C(CN(CC(O)=O)C(C)C)(=O)C1=CC=CS1
Synonyms:- Glycine, N-(1-methylethyl)-N-[2-oxo-2-(2-thienyl)ethyl]-
- N-(1-Methylethyl)-N-[2-oxo-2-(2-thienyl)ethyl]glycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.