CAS 1353978-33-2

3-(Chloromethyl)-1-piperidineacetic acid

Description:

3-(Chloromethyl)-1-piperidineacetic acid is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a chloromethyl group attached to the piperidine nitrogen, enhancing its reactivity and potential for further chemical modifications. The acetic acid moiety contributes to its acidic properties, making it a carboxylic acid derivative. This compound is typically used in organic synthesis and medicinal chemistry, where its functional groups can facilitate various reactions, such as nucleophilic substitutions or coupling reactions. The presence of the chlorine atom can also serve as a leaving group in these reactions. Additionally, the piperidine ring is known for its role in pharmacological applications, often contributing to the biological activity of compounds. Safety and handling considerations are essential due to the presence of the chloromethyl group, which can be reactive and potentially hazardous. Overall, 3-(Chloromethyl)-1-piperidineacetic acid is a versatile intermediate in chemical synthesis with applications in drug development and research.

Formula: C₈H₁₄ClNO₂

InChI: InChI=1S/C8H14ClNO2/c9-4-7-2-1-3-10(5-7)6-8(11)12/h7H,1-6H2,(H,11,12)

InChI key: InChIKey=NFELZMLBTSKUMY-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1CC(CCl)CCC1

Synonyms:

• 3-(Chloromethyl)-1-piperidineacetic acid
• 1-Piperidineacetic acid, 3-(chloromethyl)-