CAS 1353979-00-6

2-Chloro-N-[(3-methoxy-2-pyrazinyl)methyl]-N-methylacetamide

Description:

2-Chloro-N-[(3-methoxy-2-pyrazinyl)methyl]-N-methylacetamide is a chemical compound characterized by its unique structure, which includes a chloro substituent, a methoxy group, and a pyrazine ring. This compound features a chloro group attached to a nitrogen atom, which is further connected to a methoxy-substituted pyrazine moiety. The presence of the methoxy group enhances its solubility and may influence its biological activity. The acetamide functional group contributes to its potential as a pharmacological agent, as amides are often involved in drug design due to their ability to form hydrogen bonds. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutics targeting specific biological pathways. Additionally, the presence of the pyrazine ring may impart unique electronic properties, making it of interest in various chemical and biological studies. Overall, this compound exemplifies the complexity and diversity of organic molecules used in research and development.

Formula: C₉H₁₂ClN₃O₂

InChI: InChI=1S/C9H12ClN3O2/c1-13(8(14)5-10)6-7-9(15-2)12-4-3-11-7/h3-4H,5-6H2,1-2H3

InChI key: InChIKey=GQFMZLFNRIOISC-UHFFFAOYSA-N

SMILES: C(N(C(CCl)=O)C)C=1C(OC)=NC=CN1

Synonyms:

• 2-Chloro-N-[(3-methoxy-2-pyrazinyl)methyl]-N-methylacetamide
• Acetamide, 2-chloro-N-[(3-methoxy-2-pyrazinyl)methyl]-N-methyl-