CAS 1353979-17-5
:2-Chloro-N-[(6-chloro-3-pyridazinyl)methyl]acetamide
Description:
2-Chloro-N-[(6-chloro-3-pyridazinyl)methyl]acetamide is a chemical compound characterized by its unique structure, which includes a chloro group and a pyridazine moiety. This compound features an acetamide functional group, indicating its potential as an amide derivative. The presence of chlorine atoms enhances its reactivity and may influence its biological activity. The pyridazine ring contributes to the compound's aromatic properties, which can affect its solubility and interaction with biological targets. Typically, compounds like this may exhibit pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential applications in drug development, particularly in targeting specific enzymes or receptors. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2-Chloro-N-[(6-chloro-3-pyridazinyl)methyl]acetamide represents a class of compounds that may have significant implications in various fields, including pharmaceuticals and agrochemicals.
Formula:C7H7Cl2N3O
InChI:InChI=1S/C7H7Cl2N3O/c8-3-7(13)10-4-5-1-2-6(9)12-11-5/h1-2H,3-4H2,(H,10,13)
InChI key:InChIKey=NGGFRPHDKRYVAS-UHFFFAOYSA-N
SMILES:C(NC(CCl)=O)C1=CC=C(Cl)N=N1
Synonyms:- 2-Chloro-N-[(6-chloro-3-pyridazinyl)methyl]acetamide
- Acetamide, 2-chloro-N-[(6-chloro-3-pyridazinyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.