CymitQuimica logo

CAS 1353979-26-6

:

N-[4-(Cyclopropylamino)cyclohexyl]acetamide

Description:
N-[4-(Cyclopropylamino)cyclohexyl]acetamide, identified by its CAS number 1353979-26-6, is a chemical compound characterized by its unique structural features. It contains a cyclohexyl ring substituted with a cyclopropylamino group and an acetamide functional group. This compound is typically classified as an amide due to the presence of the acetamide moiety, which contributes to its potential biological activity. The cyclopropyl group can influence the compound's pharmacological properties, possibly enhancing its binding affinity to certain biological targets. The presence of both cyclohexyl and cyclopropyl groups may also affect its solubility and stability in various solvents. Additionally, the compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or enzymes. Overall, N-[4-(Cyclopropylamino)cyclohexyl]acetamide represents a class of compounds that may exhibit interesting chemical and biological properties, warranting further investigation for potential therapeutic uses.
Formula:C11H20N2O
InChI:InChI=1S/C11H20N2O/c1-8(14)12-9-2-4-10(5-3-9)13-11-6-7-11/h9-11,13H,2-7H2,1H3,(H,12,14)
InChI key:InChIKey=JYIYCSNILKCKHV-UHFFFAOYSA-N
SMILES:N(C1CCC(NC(C)=O)CC1)C2CC2
Synonyms:
  • N-[4-(Cyclopropylamino)cyclohexyl]acetamide
  • Acetamide, N-[4-(cyclopropylamino)cyclohexyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.