CAS 1353979-59-5

Phenylmethyl 2-[[(2-aminoethyl)ethylamino]methyl]-1-piperidinecarboxylate

Description:

Phenylmethyl 2-[[(2-aminoethyl)ethylamino]methyl]-1-piperidinecarboxylate, identified by its CAS number 1353979-59-5, is a chemical compound that belongs to the class of piperidine derivatives. This substance features a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and is characterized by the presence of a carboxylate functional group. The compound also contains an aminoethyl side chain, contributing to its potential biological activity. Its structure suggests that it may exhibit properties relevant to pharmacology, possibly acting as a ligand for various receptors or enzymes. The presence of both aromatic and aliphatic components in its structure may influence its solubility and reactivity. Additionally, the compound's molecular interactions could be significant in medicinal chemistry, particularly in the development of therapeutic agents. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require further investigation or experimental determination.

Formula: C₁₈H₂₉N₃O₂

InChI: InChI=1S/C18H29N3O2/c1-2-20(13-11-19)14-17-10-6-7-12-21(17)18(22)23-15-16-8-4-3-5-9-16/h3-5,8-9,17H,2,6-7,10-15,19H2,1H3

InChI key: InChIKey=PDGYKRMPXHYBRW-UHFFFAOYSA-N

SMILES: C(OCC1=CC=CC=C1)(=O)N2C(CN(CCN)CC)CCCC2

Synonyms:

• 1-Piperidinecarboxylic acid, 2-[[(2-aminoethyl)ethylamino]methyl]-, phenylmethyl ester
• Phenylmethyl 2-[[(2-aminoethyl)ethylamino]methyl]-1-piperidinecarboxylate