CAS 1353979-70-0
:Phenylmethyl N-[2-[(2-aminoethyl)ethylamino]cyclohexyl]carbamate
Description:
Phenylmethyl N-[2-[(2-aminoethyl)ethylamino]cyclohexyl]carbamate, identified by its CAS number 1353979-70-0, is a chemical compound that belongs to the class of carbamates. This substance features a phenylmethyl group attached to a carbamate functional group, which is further linked to a cyclohexyl moiety substituted with an aminoethyl chain. The presence of amino groups suggests potential for hydrogen bonding and interaction with biological systems, making it of interest in medicinal chemistry. Its structure indicates that it may exhibit properties such as moderate lipophilicity due to the phenyl and cyclohexyl groups, which could influence its solubility and permeability in biological membranes. Additionally, the aminoethyl substituents may contribute to its pharmacological activity, potentially affecting neurotransmitter systems or other biological pathways. As with many carbamate derivatives, it may also exhibit neuroactive properties, but specific biological activities would require empirical investigation. Safety and handling considerations should be observed, as with all chemical substances, particularly those with potential biological activity.
Formula:C18H29N3O2
InChI:InChI=1S/C18H29N3O2/c1-2-21(13-12-19)17-11-7-6-10-16(17)20-18(22)23-14-15-8-4-3-5-9-15/h3-5,8-9,16-17H,2,6-7,10-14,19H2,1H3,(H,20,22)
InChI key:InChIKey=YSOSCHBSMBUYLH-UHFFFAOYSA-N
SMILES:N(CCN)(CC)C1C(NC(OCC2=CC=CC=C2)=O)CCCC1
Synonyms:- Phenylmethyl N-[2-[(2-aminoethyl)ethylamino]cyclohexyl]carbamate
- Carbamic acid, N-[2-[(2-aminoethyl)ethylamino]cyclohexyl]-, phenylmethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.