CAS 1353979-75-5

4-Pyridinemethanamine, 2-bromo-N-(1-methylethyl)-, hydrochloride (1:1)

Description:

4-Pyridinemethanamine, 2-bromo-N-(1-methylethyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which contributes to its basicity and potential for forming hydrogen bonds. The presence of a bromine atom at the 2-position of the pyridine ring introduces a halogen substituent, which can influence the compound's reactivity and interaction with other molecules. The N-(1-methylethyl) group indicates the presence of an isopropyl substituent, which can affect the steric hindrance and solubility of the compound. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound may exhibit biological activity, making it of interest in medicinal chemistry. Its specific properties, such as melting point, boiling point, and spectral characteristics, would depend on the molecular interactions and the environment in which it is studied. Safety data and handling precautions should be considered due to the presence of bromine and the potential for biological activity.

Formula: C₉H₁₃BrN₂·ClH

InChI: InChI=1S/C9H13BrN2.ClH/c1-7(2)12-6-8-3-4-11-9(10)5-8;/h3-5,7,12H,6H2,1-2H3;1H

InChI key: InChIKey=WIDLFNDTKLFMFB-UHFFFAOYSA-N

SMILES: C(NC(C)C)C=1C=C(Br)N=CC1.Cl

Synonyms:

• 4-Pyridinemethanamine, 2-bromo-N-(1-methylethyl)-, hydrochloride (1:1)