CAS 1353979-86-8
:1,1-Dimethylethyl 4-[[bis[2-[[(3-chlorophenyl)methyl]cyclopropylamino]-2-oxoethyl]amino]methyl]-1-piperidinecarboxylate
Description:
1,1-Dimethylethyl 4-[[bis[2-[[(3-chlorophenyl)methyl]cyclopropylamino]-2-oxoethyl]amino]methyl]-1-piperidinecarboxylate, identified by its CAS number 1353979-86-8, is a complex organic compound characterized by its multi-functional structure. It features a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and incorporates various substituents that contribute to its biological activity. The presence of the dimethylethyl group suggests a branched alkyl chain that may enhance lipophilicity, potentially influencing its pharmacokinetic properties. The compound also contains a chlorophenyl moiety, which can impart specific electronic properties and may be involved in interactions with biological targets. Additionally, the cyclopropylamino groups indicate a degree of steric hindrance, which can affect binding affinity and selectivity. Overall, this compound's intricate structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutics targeting specific biological pathways. However, detailed studies on its pharmacological properties and safety profile would be necessary to fully understand its utility.
Formula:C35H46Cl2N4O4
InChI:InChI=1S/C35H46Cl2N4O4/c1-35(2,3)45-34(44)39-16-14-25(15-17-39)20-38(23-32(42)40(30-10-11-30)21-26-6-4-8-28(36)18-26)24-33(43)41(31-12-13-31)22-27-7-5-9-29(37)19-27/h4-9,18-19,25,30-31H,10-17,20-24H2,1-3H3
InChI key:InChIKey=SCXDVGDYKCXABK-UHFFFAOYSA-N
SMILES:N(CC1=CC(Cl)=CC=C1)(C(CN(CC2CCN(C(OC(C)(C)C)=O)CC2)CC(N(CC3=CC(Cl)=CC=C3)C4CC4)=O)=O)C5CC5
Synonyms:- 1,1-Dimethylethyl 4-[[bis[2-[[(3-chlorophenyl)methyl]cyclopropylamino]-2-oxoethyl]amino]methyl]-1-piperidinecarboxylate
- 1-Piperidinecarboxylic acid, 4-[[bis[2-[[(3-chlorophenyl)methyl]cyclopropylamino]-2-oxoethyl]amino]methyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl 4-((bis(2-((3-chlorobenzyl)(cyclopropyl)amino)-2-oxoethyl)amino)methyl)piperidine-1-carboxylate
CAS:Formula:C35H46Cl2N4O4Molecular weight:657.6701
