CAS 1353979-91-5

4-Chloro-2-ethoxy-5-methoxypyrimidine

Description:

4-Chloro-2-ethoxy-5-methoxypyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a chlorine atom, an ethoxy group, and a methoxy group. The presence of the chlorine atom at the 4-position contributes to its reactivity, while the ethoxy and methoxy groups at the 2 and 5 positions, respectively, enhance its solubility and influence its electronic properties. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. It is often utilized in pharmaceutical research and development due to its potential biological activity, particularly in the synthesis of various bioactive molecules. The functional groups present in this compound can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, 4-Chloro-2-ethoxy-5-methoxypyrimidine is an important compound in the field of medicinal chemistry and organic synthesis.

Formula: C₇H₉ClN₂O₂

InChI: InChI=1S/C7H9ClN2O2/c1-3-12-7-9-4-5(11-2)6(8)10-7/h4H,3H2,1-2H3

InChI key: InChIKey=WBSFLULQYYGJPB-UHFFFAOYSA-N

SMILES: O(CC)C=1N=C(Cl)C(OC)=CN1

Synonyms:

• 4-Chloro-2-ethoxy-5-methoxypyrimidine
• Pyrimidine, 4-chloro-2-ethoxy-5-methoxy-