CymitQuimica logo

CAS 1353979-94-8

:

3-Methoxy-N-(1-methylethyl)-2-pyrazinemethanamine

Description:
3-Methoxy-N-(1-methylethyl)-2-pyrazinemethanamine is a chemical compound characterized by its unique structure, which includes a pyrazine ring and an alkyl amine functional group. This compound features a methoxy group (-OCH3) and an isopropyl group (-C(CH3)2) attached to the nitrogen atom, contributing to its overall hydrophobic character. The presence of the pyrazine ring suggests potential biological activity, as pyrazines are often found in various natural products and pharmaceuticals. The compound's molecular structure may influence its solubility, stability, and reactivity, making it of interest in medicinal chemistry and drug development. Additionally, the specific arrangement of functional groups can affect its interaction with biological targets, potentially leading to applications in therapeutic contexts. As with many organic compounds, understanding its properties, such as melting point, boiling point, and spectral characteristics, would require experimental data or computational modeling for precise characterization. Overall, this compound exemplifies the complexity and diversity of organic molecules in chemical research.
Formula:C9H15N3O
InChI:InChI=1S/C9H15N3O/c1-7(2)12-6-8-9(13-3)11-5-4-10-8/h4-5,7,12H,6H2,1-3H3
InChI key:InChIKey=GWPMTGPFGKYQSU-UHFFFAOYSA-N
SMILES:C(NC(C)C)C=1C(OC)=NC=CN1
Synonyms:
  • 2-Pyrazinemethanamine, 3-methoxy-N-(1-methylethyl)-
  • 3-Methoxy-N-(1-methylethyl)-2-pyrazinemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.