CAS 1353980-02-5

3-[[[(4-Methylphenyl)sulfonyl]oxy]methyl]-1-piperidineacetic acid

Description:

3-[[[(4-Methylphenyl)sulfonyl]oxy]methyl]-1-piperidineacetic acid is a chemical compound characterized by its complex structure, which includes a piperidine ring, a sulfonyl group, and an acetic acid moiety. The presence of the 4-methylphenyl group contributes to its hydrophobic characteristics, while the sulfonyl group enhances its solubility in polar solvents. This compound is likely to exhibit biological activity, potentially interacting with various biological targets due to its structural features. Its piperidine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The carboxylic acid functional group may also impart acidic properties, influencing its reactivity and interaction with other molecules. Overall, this compound's unique combination of functional groups and structural elements positions it as a candidate for further research in drug development and other chemical applications. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₅H₂₁NO₅S

InChI: InChI=1S/C15H21NO5S/c1-12-4-6-14(7-5-12)22(19,20)21-11-13-3-2-8-16(9-13)10-15(17)18/h4-7,13H,2-3,8-11H2,1H3,(H,17,18)

InChI key: InChIKey=LACXHIHTBMVEHI-UHFFFAOYSA-N

SMILES: S(OCC1CN(CC(O)=O)CCC1)(=O)(=O)C2=CC=C(C)C=C2

Synonyms:

• 1-Piperidineacetic acid, 3-[[[(4-methylphenyl)sulfonyl]oxy]methyl]-
• 3-[[[(4-Methylphenyl)sulfonyl]oxy]methyl]-1-piperidineacetic acid