CAS 1353980-08-1
:1,1-Dimethylethyl N-[[1-[(2-chloro-3-pyridinyl)carbonyl]-2-piperidinyl]methyl]carbamate
Description:
1,1-Dimethylethyl N-[[1-[(2-chloro-3-pyridinyl)carbonyl]-2-piperidinyl]methyl]carbamate, identified by its CAS number 1353980-08-1, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure that includes a dimethyl group, a piperidine ring, and a pyridine moiety, which contribute to its unique chemical properties. The presence of the chloro group on the pyridine ring enhances its reactivity and potential biological activity. Typically, compounds of this nature may exhibit various pharmacological effects, making them of interest in medicinal chemistry. The molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability, solubility, and reactivity would depend on its specific functional groups and overall molecular conformation. Safety and handling precautions are essential when working with such compounds, as they may pose health risks or environmental hazards. Further studies would be necessary to fully elucidate its properties and potential uses in various fields.
Formula:C17H24ClN3O3
InChI:InChI=1S/C17H24ClN3O3/c1-17(2,3)24-16(23)20-11-12-7-4-5-10-21(12)15(22)13-8-6-9-19-14(13)18/h6,8-9,12H,4-5,7,10-11H2,1-3H3,(H,20,23)
InChI key:InChIKey=IGFVLEKXCFNUNC-UHFFFAOYSA-N
SMILES:C(=O)(N1C(CNC(OC(C)(C)C)=O)CCCC1)C2=C(Cl)N=CC=C2
Synonyms:- [1-(2-Chloro-pyridine-3-carbonyl)-piperidin-2-ylmethyl]-carbamic acid tert-butyl ester
- Carbamic acid, N-[[1-[(2-chloro-3-pyridinyl)carbonyl]-2-piperidinyl]methyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl N-[[1-[(2-chloro-3-pyridinyl)carbonyl]-2-piperidinyl]methyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl ((1-(2-chloronicotinoyl)piperidin-2-yl)methyl)carbamate
CAS:Formula:C17H24ClN3O3Color and Shape:SolidMolecular weight:353.8438
