CymitQuimica logo

CAS 1353980-09-2

:

2-[Cyclopropyl(5-thiazolylmethyl)amino]ethanol

Description:
2-[Cyclopropyl(5-thiazolylmethyl)amino]ethanol is a chemical compound characterized by its unique structural features, which include a cyclopropyl group and a thiazole moiety. The presence of the amino group indicates that it can participate in hydrogen bonding, making it potentially soluble in polar solvents. The thiazole ring contributes to the compound's biological activity, as thiazoles are often found in pharmacologically active compounds. The ethanol part of the molecule suggests that it may exhibit alcohol-like properties, which can influence its reactivity and interaction with biological systems. This compound may be of interest in medicinal chemistry due to its potential applications in drug development, particularly in targeting specific biological pathways. Its molecular structure allows for various interactions, which could be explored for therapeutic purposes. However, detailed studies on its pharmacokinetics, toxicity, and specific applications would be necessary to fully understand its characteristics and potential uses in various fields, including pharmaceuticals and biochemistry.
Formula:C9H14N2OS
InChI:InChI=1S/C9H14N2OS/c12-4-3-11(8-1-2-8)6-9-5-10-7-13-9/h5,7-8,12H,1-4,6H2
InChI key:InChIKey=HIIHIUZMPMORMC-UHFFFAOYSA-N
SMILES:N(CC1=CN=CS1)(CCO)C2CC2
Synonyms:
  • Ethanol, 2-[cyclopropyl(5-thiazolylmethyl)amino]-
  • 2-[Cyclopropyl(5-thiazolylmethyl)amino]ethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.