CymitQuimica logo

CAS 1353980-17-2

:

1-[2-[(2-Hydroxyethoxy)methyl]-1-pyrrolidinyl]ethanone

Description:
1-[2-[(2-Hydroxyethoxy)methyl]-1-pyrrolidinyl]ethanone, identified by its CAS number 1353980-17-2, is a chemical compound characterized by its unique molecular structure that includes a pyrrolidine ring and an ethanone functional group. This compound features a hydroxyethoxy side chain, which contributes to its solubility and reactivity. Typically, substances of this nature may exhibit properties such as moderate polarity due to the presence of hydroxyl groups, which can engage in hydrogen bonding. The pyrrolidine moiety often imparts certain biological activities, making such compounds of interest in medicinal chemistry. Additionally, the presence of the ethanone group suggests potential reactivity in various organic synthesis reactions, including acylation and condensation reactions. Overall, the characteristics of this compound make it a candidate for further investigation in pharmaceutical applications, particularly in the development of new therapeutic agents. However, specific physical and chemical properties such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise characterization.
Formula:C9H17NO3
InChI:InChI=1S/C9H17NO3/c1-8(12)10-4-2-3-9(10)7-13-6-5-11/h9,11H,2-7H2,1H3
InChI key:InChIKey=NPCHZHHFDCJGJD-UHFFFAOYSA-N
SMILES:C(OCCO)C1N(C(C)=O)CCC1
Synonyms:
  • Ethanone, 1-[2-[(2-hydroxyethoxy)methyl]-1-pyrrolidinyl]-
  • 1-[2-[(2-Hydroxyethoxy)methyl]-1-pyrrolidinyl]ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.