CAS 1353980-22-9
:1-[4-[(2-Hydroxyethoxy)methyl]-1-piperidinyl]ethanone
Description:
1-[4-[(2-Hydroxyethoxy)methyl]-1-piperidinyl]ethanone, with the CAS number 1353980-22-9, is a chemical compound characterized by its piperidine ring structure, which contributes to its potential biological activity. This substance features a ketone functional group, indicating it may participate in various chemical reactions typical of carbonyl compounds. The presence of a hydroxyethoxy group suggests that it has hydrophilic properties, which can enhance its solubility in polar solvents. The compound's structure implies potential interactions with biological systems, making it of interest in medicinal chemistry. Its molecular configuration may influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. Additionally, the presence of the piperidine moiety may confer specific receptor binding capabilities, which could be relevant in drug design. Overall, this compound's unique structural features position it as a candidate for further research in pharmaceutical applications, particularly in the development of therapeutics targeting various biological pathways.
Formula:C10H19NO3
InChI:InChI=1S/C10H19NO3/c1-9(13)11-4-2-10(3-5-11)8-14-7-6-12/h10,12H,2-8H2,1H3
InChI key:InChIKey=WUTOZFLWAJGOIA-UHFFFAOYSA-N
SMILES:C(OCCO)C1CCN(C(C)=O)CC1
Synonyms:- 1-[4-[(2-Hydroxyethoxy)methyl]-1-piperidinyl]ethanone
- Ethanone, 1-[4-[(2-hydroxyethoxy)methyl]-1-piperidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.