CymitQuimica logo

CAS 1353980-31-0

:

2-Amino-N-cyclopropyl-N-(1-isoquinolinylmethyl)acetamide

Description:
2-Amino-N-cyclopropyl-N-(1-isoquinolinylmethyl)acetamide is a chemical compound characterized by its unique structure, which includes an amino group, a cyclopropyl group, and an isoquinoline moiety. This compound features a central acetamide functional group, which contributes to its potential biological activity. The presence of the cyclopropyl group may influence its pharmacokinetic properties, such as metabolic stability and receptor binding affinity. The isoquinoline structure is known for its presence in various bioactive compounds, suggesting that this substance may exhibit interesting pharmacological properties. Additionally, the compound's molecular interactions could be significant in medicinal chemistry, particularly in the development of new therapeutic agents. Its specific characteristics, such as solubility, melting point, and reactivity, would depend on the overall molecular structure and the functional groups present. As with many compounds, further studies would be necessary to fully elucidate its properties and potential applications in research or pharmaceuticals.
Formula:C15H17N3O
InChI:InChI=1S/C15H17N3O/c16-9-15(19)18(12-5-6-12)10-14-13-4-2-1-3-11(13)7-8-17-14/h1-4,7-8,12H,5-6,9-10,16H2
InChI key:InChIKey=OYFMPGKRUGNDAP-UHFFFAOYSA-N
SMILES:C(N(C(CN)=O)C1CC1)C=2C3=C(C=CN2)C=CC=C3
Synonyms:
  • Acetamide, 2-amino-N-cyclopropyl-N-(1-isoquinolinylmethyl)-
  • 2-Amino-N-cyclopropyl-N-(1-isoquinolinylmethyl)acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.