CAS 1353980-47-8

3-Iodo-1-pyrrolidineacetic acid

Description:

3-Iodo-1-pyrrolidineacetic acid is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and an acetic acid moiety, along with an iodine substituent at the third position of the pyrrolidine. This compound is typically classified as an amino acid derivative due to the presence of both an amine and a carboxylic acid functional group. The iodine atom introduces notable properties, such as increased molecular weight and potential for enhanced reactivity, particularly in nucleophilic substitution reactions. The presence of the pyrrolidine ring contributes to its cyclic structure, which can influence its conformational flexibility and biological activity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its solubility and stability can vary based on the pH and solvent conditions, which are important considerations for its application in research and potential therapeutic uses. Overall, 3-Iodo-1-pyrrolidineacetic acid represents a versatile scaffold for further chemical modifications and investigations.

Formula: C₆H₁₀INO₂

InChI: InChI=1S/C6H10INO2/c7-5-1-2-8(3-5)4-6(9)10/h5H,1-4H2,(H,9,10)

InChI key: InChIKey=IKIQRRMDYHKIMG-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1CC(I)CC1

Synonyms:

• 3-Iodo-1-pyrrolidineacetic acid
• 1-Pyrrolidineacetic acid, 3-iodo-
• (3-Iodo-pyrrolidin-1-yl)-acetic acid
• 2-(3-Iodopyrrolidin-1-yl)acetic acid